C54H50N8 — CID 59372260
2,6-ditert-butyl-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis[4-(1,3,5-triazin-2-yl)phenyl]anthracene-9,10-diamine (PubChem CID 59372260) has the molecular formula C54H50N8 and a molecular weight of 811.05 g/mol. Its IUPAC name is 2,6-ditert-butyl-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis[4-(1,3,5-triazin-2-yl)phenyl]anthracene-9,10-diamine.
| Compound Name | 2,6-ditert-butyl-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis[4-(1,3,5-triazin-2-yl)phenyl]anthracene-9,10-diamine |
|---|---|
| PubChem CID | 59372260 |
| Molecular Formula | C54H50N8 |
| Molecular Weight | 811.05 g/mol |
| Exact Mass | 810.42 |
| IUPAC Name | 2,6-ditert-butyl-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis[4-(1,3,5-triazin-2-yl)phenyl]anthracene-9,10-diamine |
| SMILES | Cc1ccc(N(c2ccc(-c3ncncn3)cc2)c2c3ccc(C(C)(C)C)cc3c(N(c3ccc(C)cc3)c3ccc(-c4ncncn4)cc3)c3ccc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C54H50N8/c1-35-9-19-41(20-10-35)61(43-23-13-37(14-24-43)51-57-31-55-32-58-51)49-45-27-17-40(54(6,7)8)30-48(45)50(46-28-18-39(29-47(46)49)53(3,4)5)62(42-21-11-36(2)12-22-42)44-25-15-38(16-26-44)52-59-33-56-34-60-52/h9-34H,1-8H3 |
| InChIKey | YALFRKKRNNTTPM-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 83.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.05 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|