C64H80N2O2 — CID 59372339
2,6-ditert-butyl-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-octoxyphenyl)anthracene-9,10-diamine (PubChem CID 59372339) has the molecular formula C64H80N2O2 and a molecular weight of 909.36 g/mol. Its IUPAC name is 2,6-ditert-butyl-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-octoxyphenyl)anthracene-9,10-diamine.
| Compound Name | 2,6-ditert-butyl-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-octoxyphenyl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 59372339 |
| Molecular Formula | C64H80N2O2 |
| Molecular Weight | 909.36 g/mol |
| Exact Mass | 908.62 |
| IUPAC Name | 2,6-ditert-butyl-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-octoxyphenyl)anthracene-9,10-diamine |
| SMILES | CCCCCCCCOc1ccc(N(c2ccc(C)cc2)c2c3ccc(C(C)(C)C)cc3c(N(c3ccc(C)cc3)c3ccc(OCCCCCCCC)cc3)c3ccc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C64H80N2O2/c1-11-13-15-17-19-21-43-67-55-37-33-53(34-38-55)65(51-29-23-47(3)24-30-51)61-57-41-27-50(64(8,9)10)46-60(57)62(58-42-28-49(45-59(58)61)63(5,6)7)66(52-31-25-48(4)26-32-52)54-35-39-56(40-36-54)68-44-22-20-18-16-14-12-2/h23-42,45-46H,11-22,43-44H2,1-10H3 |
| InChIKey | VSJFYWWWHXGBOP-UHFFFAOYSA-N |
| XLogP | 19.62 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.36 |
| LogP ≤ 5 | 19.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|