C60H56N2S2 — CID 59372318
9-N,10-N-bis(4-tert-butylphenyl)-9-N,10-N-bis(4-methylphenyl)-2,6-bis(phenylsulfanyl)anthracene-9,10-diamine (PubChem CID 59372318) has the molecular formula C60H56N2S2 and a molecular weight of 869.26 g/mol. Its IUPAC name is 9-N,10-N-bis(4-tert-butylphenyl)-9-N,10-N-bis(4-methylphenyl)-2,6-bis(phenylsulfanyl)anthracene-9,10-diamine.
| Compound Name | 9-N,10-N-bis(4-tert-butylphenyl)-9-N,10-N-bis(4-methylphenyl)-2,6-bis(phenylsulfanyl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 59372318 |
| Molecular Formula | C60H56N2S2 |
| Molecular Weight | 869.26 g/mol |
| Exact Mass | 868.39 |
| IUPAC Name | 9-N,10-N-bis(4-tert-butylphenyl)-9-N,10-N-bis(4-methylphenyl)-2,6-bis(phenylsulfanyl)anthracene-9,10-diamine |
| SMILES | Cc1ccc(N(c2ccc(C(C)(C)C)cc2)c2c3ccc(Sc4ccccc4)cc3c(N(c3ccc(C)cc3)c3ccc(C(C)(C)C)cc3)c3ccc(Sc4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C60H56N2S2/c1-41-19-27-45(28-20-41)61(47-31-23-43(24-32-47)59(3,4)5)57-53-37-35-52(64-50-17-13-10-14-18-50)40-56(53)58(54-38-36-51(39-55(54)57)63-49-15-11-9-12-16-49)62(46-29-21-42(2)22-30-46)48-33-25-44(26-34-48)60(6,7)8/h9-40H,1-8H3 |
| InChIKey | ORCRAQOJTHBYJD-UHFFFAOYSA-N |
| XLogP | 18.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.26 |
| LogP ≤ 5 | 18.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|