C49H50N2 — CID 144657375
2-N,7-N-bis(4-tert-butylphenyl)-9,10-dimethyl-2-N-(4-methylphenyl)-7-N-phenylphenanthrene-2,7-diamine (PubChem CID 144657375) has the molecular formula C49H50N2 and a molecular weight of 666.95 g/mol. Its IUPAC name is 2-N,7-N-bis(4-tert-butylphenyl)-9,10-dimethyl-2-N-(4-methylphenyl)-7-N-phenylphenanthrene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(4-tert-butylphenyl)-9,10-dimethyl-2-N-(4-methylphenyl)-7-N-phenylphenanthrene-2,7-diamine |
|---|---|
| PubChem CID | 144657375 |
| Molecular Formula | C49H50N2 |
| Molecular Weight | 666.95 g/mol |
| Exact Mass | 666.40 |
| IUPAC Name | 2-N,7-N-bis(4-tert-butylphenyl)-9,10-dimethyl-2-N-(4-methylphenyl)-7-N-phenylphenanthrene-2,7-diamine |
| SMILES | Cc1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)c(C)c(C)c2cc(N(c4ccccc4)c4ccc(C(C)(C)C)cc4)ccc23)cc1 |
| InChI | InChI=1S/C49H50N2/c1-33-15-21-39(22-16-33)51(41-25-19-37(20-26-41)49(7,8)9)43-28-30-45-44-29-27-42(31-46(44)34(2)35(3)47(45)32-43)50(38-13-11-10-12-14-38)40-23-17-36(18-24-40)48(4,5)6/h10-32H,1-9H3 |
| InChIKey | PEEQTCBSEWECRB-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.95 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|