C27H33N — CID 139326638
N,N-bis(4-tert-butylphenyl)-3-methylaniline (PubChem CID 139326638) has the molecular formula C27H33N and a molecular weight of 371.57 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-3-methylaniline.
| Compound Name | N,N-bis(4-tert-butylphenyl)-3-methylaniline |
|---|---|
| PubChem CID | 139326638 |
| Molecular Formula | C27H33N |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-3-methylaniline |
| SMILES | Cc1cccc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C27H33N/c1-20-9-8-10-25(19-20)28(23-15-11-21(12-16-23)26(2,3)4)24-17-13-22(14-18-24)27(5,6)7/h8-19H,1-7H3 |
| InChIKey | MVLQUJLDWITQPZ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |