C26H30IN — CID 142315159
N,N-bis(4-tert-butylphenyl)-3-iodoaniline (PubChem CID 142315159) has the molecular formula C26H30IN and a molecular weight of 483.44 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-3-iodoaniline.
| Compound Name | N,N-bis(4-tert-butylphenyl)-3-iodoaniline |
|---|---|
| PubChem CID | 142315159 |
| Molecular Formula | C26H30IN |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-3-iodoaniline |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cccc(I)c2)cc1 |
| InChI | InChI=1S/C26H30IN/c1-25(2,3)19-10-14-22(15-11-19)28(24-9-7-8-21(27)18-24)23-16-12-20(13-17-23)26(4,5)6/h7-18H,1-6H3 |
| InChIKey | QKVANWKXKGELRT-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|