C96H110N4 — CID 167403972
1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(4-tert-butylphenyl)pyrene-1,3,6,8-tetramine (PubChem CID 167403972) has the molecular formula C96H110N4 and a molecular weight of 1319.96 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(4-tert-butylphenyl)pyrene-1,3,6,8-tetramine.
| Compound Name | 1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(4-tert-butylphenyl)pyrene-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 167403972 |
| Molecular Formula | C96H110N4 |
| Molecular Weight | 1319.96 g/mol |
| Exact Mass | 1318.87 |
| IUPAC Name | 1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(4-tert-butylphenyl)pyrene-1,3,6,8-tetramine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc(N(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)c3ccc4c(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)cc(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C96H110N4/c1-89(2,3)63-25-41-71(42-26-63)97(72-43-27-64(28-44-72)90(4,5)6)83-61-84(98(73-45-29-65(30-46-73)91(7,8)9)74-47-31-66(32-48-74)92(10,11)12)80-59-60-82-86(100(77-53-37-69(38-54-77)95(19,20)21)78-55-39-70(40-56-78)96(22,23)24)62-85(81-58-57-79(83)87(80)88(81)82)99(75-49-33-67(34-50-75)93(13,14)15)76-51-35-68(36-52-76)94(16,17)18/h25-62H,1-24H3 |
| InChIKey | ROAORRMGQQUGLV-UHFFFAOYSA-N |
| XLogP | 28.84 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 100 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1319.96 |
| LogP ≤ 5 | 28.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|