C56H60N2 — CID 146497193
1-N,1-N,3-N,3-N-tetrakis(4-tert-butylphenyl)pyrene-1,3-diamine (PubChem CID 146497193) has the molecular formula C56H60N2 and a molecular weight of 761.11 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrakis(4-tert-butylphenyl)pyrene-1,3-diamine.
| Compound Name | 1-N,1-N,3-N,3-N-tetrakis(4-tert-butylphenyl)pyrene-1,3-diamine |
|---|---|
| PubChem CID | 146497193 |
| Molecular Formula | C56H60N2 |
| Molecular Weight | 761.11 g/mol |
| Exact Mass | 760.48 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrakis(4-tert-butylphenyl)pyrene-1,3-diamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc(N(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)c3ccc4cccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C56H60N2/c1-53(2,3)39-18-26-43(27-19-39)57(44-28-20-40(21-29-44)54(4,5)6)49-36-50(48-35-17-38-15-13-14-37-16-34-47(49)52(48)51(37)38)58(45-30-22-41(23-31-45)55(7,8)9)46-32-24-42(25-33-46)56(10,11)12/h13-36H,1-12H3 |
| InChIKey | CUFSRWZWCDPCNE-UHFFFAOYSA-N |
| XLogP | 16.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.11 |
| LogP ≤ 5 | 16.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|