C34H35N — CID 177481694
N,N-bis(4-tert-butylphenyl)phenanthren-9-amine (PubChem CID 177481694) has the molecular formula C34H35N and a molecular weight of 457.66 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)phenanthren-9-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)phenanthren-9-amine |
|---|---|
| PubChem CID | 177481694 |
| Molecular Formula | C34H35N |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)phenanthren-9-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc3ccccc3c3ccccc23)cc1 |
| InChI | InChI=1S/C34H35N/c1-33(2,3)25-15-19-27(20-16-25)35(28-21-17-26(18-22-28)34(4,5)6)32-23-24-11-7-8-12-29(24)30-13-9-10-14-31(30)32/h7-23H,1-6H3 |
| InChIKey | LSWLOADATSJQRD-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|