C80H108N2 — CID 164817666
3,8-ditert-butyl-1-N,1-N,6-N,6-N-tetrakis(3,5-ditert-butylphenyl)pyrene-1,6-diamine (PubChem CID 164817666) has the molecular formula C80H108N2 and a molecular weight of 1097.76 g/mol. Its IUPAC name is 3,8-ditert-butyl-1-N,1-N,6-N,6-N-tetrakis(3,5-ditert-butylphenyl)pyrene-1,6-diamine.
| Compound Name | 3,8-ditert-butyl-1-N,1-N,6-N,6-N-tetrakis(3,5-ditert-butylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 164817666 |
| Molecular Formula | C80H108N2 |
| Molecular Weight | 1097.76 g/mol |
| Exact Mass | 1096.85 |
| IUPAC Name | 3,8-ditert-butyl-1-N,1-N,6-N,6-N-tetrakis(3,5-ditert-butylphenyl)pyrene-1,6-diamine |
| SMILES | CC(C)(C)c1cc(N(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)c3ccc4c(N(c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5cc(C(C)(C)C)cc(C(C)(C)C)c5)cc(C(C)(C)C)c5ccc2c3c45)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C80H108N2/c1-71(2,3)49-35-50(72(4,5)6)40-57(39-49)81(58-41-51(73(7,8)9)36-52(42-58)74(10,11)12)67-47-65(79(25,26)27)61-32-34-64-68(48-66(80(28,29)30)62-31-33-63(67)69(61)70(62)64)82(59-43-53(75(13,14)15)37-54(44-59)76(16,17)18)60-45-55(77(19,20)21)38-56(46-60)78(22,23)24/h31-48H,1-30H3 |
| InChIKey | LYYVYZPRKPNTOK-UHFFFAOYSA-N |
| XLogP | 24.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.76 |
| LogP ≤ 5 | 24.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|