C36H28N2O4 — CID 176881179
3-tert-butyl-1-N,1-N,6-N,6-N-tetrakis(furan-2-yl)pyrene-1,6-diamine (PubChem CID 176881179) has the molecular formula C36H28N2O4 and a molecular weight of 552.63 g/mol. Its IUPAC name is 3-tert-butyl-1-N,1-N,6-N,6-N-tetrakis(furan-2-yl)pyrene-1,6-diamine.
| Compound Name | 3-tert-butyl-1-N,1-N,6-N,6-N-tetrakis(furan-2-yl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 176881179 |
| Molecular Formula | C36H28N2O4 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 3-tert-butyl-1-N,1-N,6-N,6-N-tetrakis(furan-2-yl)pyrene-1,6-diamine |
| SMILES | CC(C)(C)c1cc(N(c2ccco2)c2ccco2)c2ccc3ccc(N(c4ccco4)c4ccco4)c4ccc1c2c34 |
| InChI | InChI=1S/C36H28N2O4/c1-36(2,3)27-22-29(38(32-10-6-20-41-32)33-11-7-21-42-33)26-14-12-23-13-17-28(25-16-15-24(27)35(26)34(23)25)37(30-8-4-18-39-30)31-9-5-19-40-31/h4-22H,1-3H3 |
| InChIKey | PBVXMECOLQNZIH-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|