C78H104N2 — CID 155793498
1-N,1-N,6-N,6-N-tetrakis(3,5-ditert-butylphenyl)-3,8-di(propan-2-yl)pyrene-1,6-diamine (PubChem CID 155793498) has the molecular formula C78H104N2 and a molecular weight of 1069.70 g/mol. Its IUPAC name is 1-N,1-N,6-N,6-N-tetrakis(3,5-ditert-butylphenyl)-3,8-di(propan-2-yl)pyrene-1,6-diamine.
| Compound Name | 1-N,1-N,6-N,6-N-tetrakis(3,5-ditert-butylphenyl)-3,8-di(propan-2-yl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 155793498 |
| Molecular Formula | C78H104N2 |
| Molecular Weight | 1069.70 g/mol |
| Exact Mass | 1068.82 |
| IUPAC Name | 1-N,1-N,6-N,6-N-tetrakis(3,5-ditert-butylphenyl)-3,8-di(propan-2-yl)pyrene-1,6-diamine |
| SMILES | CC(C)c1cc(N(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccc3c(C(C)C)cc(N(c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc1c2c34 |
| InChI | InChI=1S/C78H104N2/c1-47(2)65-45-67(79(57-37-49(71(5,6)7)33-50(38-57)72(8,9)10)58-39-51(73(11,12)13)34-52(40-58)74(14,15)16)63-32-30-62-66(48(3)4)46-68(64-31-29-61(65)69(63)70(62)64)80(59-41-53(75(17,18)19)35-54(42-59)76(20,21)22)60-43-55(77(23,24)25)36-56(44-60)78(26,27)28/h29-48H,1-28H3 |
| InChIKey | CAWYLVIGQZFHCD-UHFFFAOYSA-N |
| XLogP | 24.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.70 |
| LogP ≤ 5 | 24.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|