C49H37N5 — CID 122416635
4-(N-[6-(4-cyano-N-(4-cyanophenyl)anilino)-3,8-di(propan-2-yl)pyren-1-yl]anilino)benzonitrile (PubChem CID 122416635) has the molecular formula C49H37N5 and a molecular weight of 695.87 g/mol. Its IUPAC name is 4-(N-[6-(4-cyano-N-(4-cyanophenyl)anilino)-3,8-di(propan-2-yl)pyren-1-yl]anilino)benzonitrile.
| Compound Name | 4-(N-[6-(4-cyano-N-(4-cyanophenyl)anilino)-3,8-di(propan-2-yl)pyren-1-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 122416635 |
| Molecular Formula | C49H37N5 |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 4-(N-[6-(4-cyano-N-(4-cyanophenyl)anilino)-3,8-di(propan-2-yl)pyren-1-yl]anilino)benzonitrile |
| SMILES | CC(C)c1cc(N(c2ccccc2)c2ccc(C#N)cc2)c2ccc3c(C(C)C)cc(N(c4ccc(C#N)cc4)c4ccc(C#N)cc4)c4ccc1c2c34 |
| InChI | InChI=1S/C49H37N5/c1-31(2)44-26-46(53(36-8-6-5-7-9-36)37-16-10-33(28-50)11-17-37)42-24-22-41-45(32(3)4)27-47(43-25-23-40(44)48(42)49(41)43)54(38-18-12-34(29-51)13-19-38)39-20-14-35(30-52)15-21-39/h5-27,31-32H,1-4H3 |
| InChIKey | MTZYKVJDYLICDZ-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|