C74H58N4 — CID 129062801
4-(N-[6-(4-cyano-N-(2-methyl-5-phenylphenyl)-3-phenylanilino)-3,8-di(propan-2-yl)pyren-1-yl]-2-methyl-5-phenylanilino)-2-phenylbenzonitrile (PubChem CID 129062801) has the molecular formula C74H58N4 and a molecular weight of 1003.31 g/mol. Its IUPAC name is 4-(N-[6-(4-cyano-N-(2-methyl-5-phenylphenyl)-3-phenylanilino)-3,8-di(propan-2-yl)pyren-1-yl]-2-methyl-5-phenylanilino)-2-phenylbenzonitrile.
| Compound Name | 4-(N-[6-(4-cyano-N-(2-methyl-5-phenylphenyl)-3-phenylanilino)-3,8-di(propan-2-yl)pyren-1-yl]-2-methyl-5-phenylanilino)-2-phenylbenzonitrile |
|---|---|
| PubChem CID | 129062801 |
| Molecular Formula | C74H58N4 |
| Molecular Weight | 1003.31 g/mol |
| Exact Mass | 1002.47 |
| IUPAC Name | 4-(N-[6-(4-cyano-N-(2-methyl-5-phenylphenyl)-3-phenylanilino)-3,8-di(propan-2-yl)pyren-1-yl]-2-methyl-5-phenylanilino)-2-phenylbenzonitrile |
| SMILES | Cc1ccc(-c2ccccc2)cc1N(c1ccc(C#N)c(-c2ccccc2)c1)c1cc(C(C)C)c2ccc3c(N(c4ccc(C#N)c(-c5ccccc5)c4)c4cc(-c5ccccc5)ccc4C)cc(C(C)C)c4ccc1c2c43 |
| InChI | InChI=1S/C74H58N4/c1-47(2)65-43-71(77(69-39-55(29-27-49(69)5)51-19-11-7-12-20-51)59-33-31-57(45-75)67(41-59)53-23-15-9-16-24-53)63-38-36-62-66(48(3)4)44-72(64-37-35-61(65)73(63)74(62)64)78(70-40-56(30-28-50(70)6)52-21-13-8-14-22-52)60-34-32-58(46-76)68(42-60)54-25-17-10-18-26-54/h7-44,47-48H,1-6H3 |
| InChIKey | PPMBIVQNRNGJTQ-UHFFFAOYSA-N |
| XLogP | 20.80 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.31 |
| LogP ≤ 5 | 20.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|