C66H68N2Si2 — CID 140793532
1-N,6-N-bis(2-methyl-5-phenylphenyl)-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine (PubChem CID 140793532) has the molecular formula C66H68N2Si2 and a molecular weight of 945.46 g/mol. Its IUPAC name is 1-N,6-N-bis(2-methyl-5-phenylphenyl)-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(2-methyl-5-phenylphenyl)-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 140793532 |
| Molecular Formula | C66H68N2Si2 |
| Molecular Weight | 945.46 g/mol |
| Exact Mass | 944.49 |
| IUPAC Name | 1-N,6-N-bis(2-methyl-5-phenylphenyl)-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
| SMILES | Cc1ccc(-c2ccccc2)cc1N(c1ccc([Si](C)(C)C)cc1)c1cc(C(C)C)c2ccc3c(N(c4ccc([Si](C)(C)C)cc4)c4cc(-c5ccccc5)ccc4C)cc(C(C)C)c4ccc1c2c43 |
| InChI | InChI=1S/C66H68N2Si2/c1-43(2)59-41-63(67(51-27-31-53(32-28-51)69(7,8)9)61-39-49(25-23-45(61)5)47-19-15-13-16-20-47)57-38-36-56-60(44(3)4)42-64(58-37-35-55(59)65(57)66(56)58)68(52-29-33-54(34-30-52)70(10,11)12)62-40-50(26-24-46(62)6)48-21-17-14-18-22-48/h13-44H,1-12H3 |
| InChIKey | OPZUTNUWGPVUTJ-UHFFFAOYSA-N |
| XLogP | 18.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.46 |
| LogP ≤ 5 | 18.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|