C68H72N2S2 — CID 145044695
1-N,6-N-bis(4-methylphenyl)-1-N,6-N-bis[2-methyl-5-phenyl-4-(trimethyl-λ4-sulfanyl)phenyl]-3,8-di(propan-2-yl)pyrene-1,6-diamine (PubChem CID 145044695) has the molecular formula C68H72N2S2 and a molecular weight of 981.47 g/mol. Its IUPAC name is 1-N,6-N-bis(4-methylphenyl)-1-N,6-N-bis[2-methyl-5-phenyl-4-(trimethyl-λ4-sulfanyl)phenyl]-3,8-di(propan-2-yl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(4-methylphenyl)-1-N,6-N-bis[2-methyl-5-phenyl-4-(trimethyl-λ4-sulfanyl)phenyl]-3,8-di(propan-2-yl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 145044695 |
| Molecular Formula | C68H72N2S2 |
| Molecular Weight | 981.47 g/mol |
| Exact Mass | 980.51 |
| IUPAC Name | 1-N,6-N-bis(4-methylphenyl)-1-N,6-N-bis[2-methyl-5-phenyl-4-(trimethyl-λ4-sulfanyl)phenyl]-3,8-di(propan-2-yl)pyrene-1,6-diamine |
| SMILES | Cc1ccc(N(c2cc(-c3ccccc3)c(S(C)(C)C)cc2C)c2cc(C(C)C)c3ccc4c(N(c5ccc(C)cc5)c5cc(-c6ccccc6)c(S(C)(C)C)cc5C)cc(C(C)C)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C68H72N2S2/c1-43(2)57-39-63(69(51-29-25-45(5)26-30-51)61-41-59(49-21-17-15-18-22-49)65(37-47(61)7)71(9,10)11)55-36-34-54-58(44(3)4)40-64(56-35-33-53(57)67(55)68(54)56)70(52-31-27-46(6)28-32-52)62-42-60(50-23-19-16-20-24-50)66(38-48(62)8)72(12,13)14/h15-44H,1-14H3 |
| InChIKey | CVVCXJCZPZMJGT-UHFFFAOYSA-N |
| XLogP | 20.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.47 |
| LogP ≤ 5 | 20.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|