C46H26N6 — CID 88561165
4-(4-cyano-N-[12-(4-cyano-N-(4-cyanophenyl)anilino)chrysen-6-yl]anilino)benzonitrile (PubChem CID 88561165) has the molecular formula C46H26N6 and a molecular weight of 662.76 g/mol. Its IUPAC name is 4-(4-cyano-N-[12-(4-cyano-N-(4-cyanophenyl)anilino)chrysen-6-yl]anilino)benzonitrile.
| Compound Name | 4-(4-cyano-N-[12-(4-cyano-N-(4-cyanophenyl)anilino)chrysen-6-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 88561165 |
| Molecular Formula | C46H26N6 |
| Molecular Weight | 662.76 g/mol |
| Exact Mass | 662.22 |
| IUPAC Name | 4-(4-cyano-N-[12-(4-cyano-N-(4-cyanophenyl)anilino)chrysen-6-yl]anilino)benzonitrile |
| SMILES | N#Cc1ccc(N(c2ccc(C#N)cc2)c2cc3c4ccccc4c(N(c4ccc(C#N)cc4)c4ccc(C#N)cc4)cc3c3ccccc23)cc1 |
| InChI | InChI=1S/C46H26N6/c47-27-31-9-17-35(18-10-31)51(36-19-11-32(28-48)12-20-36)45-26-44-40-6-2-4-8-42(40)46(25-43(44)39-5-1-3-7-41(39)45)52(37-21-13-33(29-49)14-22-37)38-23-15-34(30-50)16-24-38/h1-26H |
| InChIKey | PVPFKSVXPKWAQR-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 101.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.76 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|