C50H40N4 — CID 58050602
4-(N-[12-(N-(4-isocyanophenyl)-4-propan-2-ylanilino)chrysen-6-yl]-4-propan-2-ylanilino)benzonitrile (PubChem CID 58050602) has the molecular formula C50H40N4 and a molecular weight of 696.90 g/mol. Its IUPAC name is 4-(N-[12-(N-(4-isocyanophenyl)-4-propan-2-ylanilino)chrysen-6-yl]-4-propan-2-ylanilino)benzonitrile.
| Compound Name | 4-(N-[12-(N-(4-isocyanophenyl)-4-propan-2-ylanilino)chrysen-6-yl]-4-propan-2-ylanilino)benzonitrile |
|---|---|
| PubChem CID | 58050602 |
| Molecular Formula | C50H40N4 |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | 4-(N-[12-(N-(4-isocyanophenyl)-4-propan-2-ylanilino)chrysen-6-yl]-4-propan-2-ylanilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(C(C)C)cc2)c2cc3c4ccccc4c(N(c4ccc(C#N)cc4)c4ccc(C(C)C)cc4)cc3c3ccccc23)cc1 |
| InChI | InChI=1S/C50H40N4/c1-33(2)36-16-24-40(25-17-36)53(39-22-14-35(32-51)15-23-39)49-30-47-44-11-7-9-13-46(44)50(31-48(47)43-10-6-8-12-45(43)49)54(42-28-20-38(52-5)21-29-42)41-26-18-37(19-27-41)34(3)4/h6-31,33-34H,1-4H3 |
| InChIKey | YRHRVQJQLPODGT-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.90 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|