C32H18N2 — CID 89027091
4-[12-(4-isocyanophenyl)chrysen-6-yl]benzonitrile (PubChem CID 89027091) has the molecular formula C32H18N2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-[12-(4-isocyanophenyl)chrysen-6-yl]benzonitrile.
| Compound Name | 4-[12-(4-isocyanophenyl)chrysen-6-yl]benzonitrile |
|---|---|
| PubChem CID | 89027091 |
| Molecular Formula | C32H18N2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-[12-(4-isocyanophenyl)chrysen-6-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2cc3c4ccccc4c(-c4ccc(C#N)cc4)cc3c3ccccc23)cc1 |
| InChI | InChI=1S/C32H18N2/c1-34-24-16-14-23(15-17-24)30-19-32-27-8-4-2-6-25(27)29(22-12-10-21(20-33)11-13-22)18-31(32)28-9-5-3-7-26(28)30/h2-19H |
| InChIKey | KVCRFDIABUBZTF-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|