C21H9N3 — CID 59565898
10-isocyanotriphenylene-2,6-dicarbonitrile (PubChem CID 59565898) has the molecular formula C21H9N3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 10-isocyanotriphenylene-2,6-dicarbonitrile.
| Compound Name | 10-isocyanotriphenylene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 59565898 |
| Molecular Formula | C21H9N3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 10-isocyanotriphenylene-2,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc2c3cc(C#N)ccc3c3cc(C#N)ccc3c2c1 |
| InChI | InChI=1S/C21H9N3/c1-24-15-4-7-18-20-9-13(11-22)2-5-16(20)19-8-14(12-23)3-6-17(19)21(18)10-15/h2-10H |
| InChIKey | HIEMHTXQEZQIBE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 51.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|