C42H18N8 — CID 155646994
9-[2-cyano-5-(3-cyanophenyl)-3-(3,6-diisocyanocarbazol-9-yl)phenyl]carbazole-3,6-dicarbonitrile (PubChem CID 155646994) has the molecular formula C42H18N8 and a molecular weight of 634.66 g/mol. Its IUPAC name is 9-[2-cyano-5-(3-cyanophenyl)-3-(3,6-diisocyanocarbazol-9-yl)phenyl]carbazole-3,6-dicarbonitrile.
| Compound Name | 9-[2-cyano-5-(3-cyanophenyl)-3-(3,6-diisocyanocarbazol-9-yl)phenyl]carbazole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 155646994 |
| Molecular Formula | C42H18N8 |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | 9-[2-cyano-5-(3-cyanophenyl)-3-(3,6-diisocyanocarbazol-9-yl)phenyl]carbazole-3,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc([N+]#[C-])ccc1n2-c1cc(-c2cccc(C#N)c2)cc(-n2c3ccc(C#N)cc3c3cc(C#N)ccc32)c1C#N |
| InChI | InChI=1S/C42H18N8/c1-47-30-8-12-39-34(19-30)35-20-31(48-2)9-13-40(35)50(39)42-18-29(28-5-3-4-25(14-28)21-43)17-41(36(42)24-46)49-37-10-6-26(22-44)15-32(37)33-16-27(23-45)7-11-38(33)49/h3-20H |
| InChIKey | VQKLKNKULKTOHR-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 113.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|