C43H21N3 — CID 123275587
4-[16-(4-cyanophenyl)-10-isocyano-7-heptacyclo[18.7.1.02,19.04,17.05,14.08,13.024,28]octacosa-1(27),2,4,6,8(13),9,11,14,16,18,20,22,24(28),25-tetradecaenyl]benzonitrile (PubChem CID 123275587) has the molecular formula C43H21N3 and a molecular weight of 579.66 g/mol. Its IUPAC name is 4-[16-(4-cyanophenyl)-10-isocyano-7-heptacyclo[18.7.1.02,19.04,17.05,14.08,13.024,28]octacosa-1(27),2,4,6,8(13),9,11,14,16,18,20,22,24(28),25-tetradecaenyl]benzonitrile.
| Compound Name | 4-[16-(4-cyanophenyl)-10-isocyano-7-heptacyclo[18.7.1.02,19.04,17.05,14.08,13.024,28]octacosa-1(27),2,4,6,8(13),9,11,14,16,18,20,22,24(28),25-tetradecaenyl]benzonitrile |
|---|---|
| PubChem CID | 123275587 |
| Molecular Formula | C43H21N3 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 4-[16-(4-cyanophenyl)-10-isocyano-7-heptacyclo[18.7.1.02,19.04,17.05,14.08,13.024,28]octacosa-1(27),2,4,6,8(13),9,11,14,16,18,20,22,24(28),25-tetradecaenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c(-c1ccc(C#N)cc1)cc1c3cc4c(cc3c(-c3ccc(C#N)cc3)cc21)-c1cccc2cccc-4c12 |
| InChI | InChI=1S/C43H21N3/c1-46-30-16-17-31-36(18-30)34(27-12-8-25(23-44)9-13-27)20-41-37(31)19-35(28-14-10-26(24-45)11-15-28)40-21-38-32-6-2-4-29-5-3-7-33(43(29)32)39(38)22-42(40)41/h2-22H |
| InChIKey | CJDQCCGDRCKMHW-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 51.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|