C47H29N3 — CID 118267415
7,16-bis(4-cyano-2,6-dimethylphenyl)heptacyclo[18.7.1.02,19.04,17.05,14.08,13.024,28]octacosa-1(27),2,4,6,8(13),9,11,14,16,18,20,22,24(28),25-tetradecaene-10-carbonitrile (PubChem CID 118267415) has the molecular formula C47H29N3 and a molecular weight of 635.77 g/mol. Its IUPAC name is 7,16-bis(4-cyano-2,6-dimethylphenyl)heptacyclo[18.7.1.02,19.04,17.05,14.08,13.024,28]octacosa-1(27),2,4,6,8(13),9,11,14,16,18,20,22,24(28),25-tetradecaene-10-carbonitrile.
| Compound Name | 7,16-bis(4-cyano-2,6-dimethylphenyl)heptacyclo[18.7.1.02,19.04,17.05,14.08,13.024,28]octacosa-1(27),2,4,6,8(13),9,11,14,16,18,20,22,24(28),25-tetradecaene-10-carbonitrile |
|---|---|
| PubChem CID | 118267415 |
| Molecular Formula | C47H29N3 |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | 7,16-bis(4-cyano-2,6-dimethylphenyl)heptacyclo[18.7.1.02,19.04,17.05,14.08,13.024,28]octacosa-1(27),2,4,6,8(13),9,11,14,16,18,20,22,24(28),25-tetradecaene-10-carbonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1-c1cc2c3cc4c(cc3c(-c3c(C)cc(C#N)cc3C)cc2c2ccc(C#N)cc12)-c1cccc2cccc-4c12 |
| InChI | InChI=1S/C47H29N3/c1-25-13-30(23-49)14-26(2)45(25)43-21-41-37(33-12-11-29(22-48)17-36(33)43)20-44(46-27(3)15-31(24-50)16-28(46)4)42-19-39-35-10-6-8-32-7-5-9-34(47(32)35)38(39)18-40(41)42/h5-21H,1-4H3 |
| InChIKey | LPNDVHMDAQPKPV-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|