C45H30N2 — CID 118264597
4-[12-(4-cyanophenyl)-2-(8-propan-2-ylnaphthalen-1-yl)chrysen-6-yl]benzonitrile (PubChem CID 118264597) has the molecular formula C45H30N2 and a molecular weight of 598.75 g/mol. Its IUPAC name is 4-[12-(4-cyanophenyl)-2-(8-propan-2-ylnaphthalen-1-yl)chrysen-6-yl]benzonitrile.
| Compound Name | 4-[12-(4-cyanophenyl)-2-(8-propan-2-ylnaphthalen-1-yl)chrysen-6-yl]benzonitrile |
|---|---|
| PubChem CID | 118264597 |
| Molecular Formula | C45H30N2 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 4-[12-(4-cyanophenyl)-2-(8-propan-2-ylnaphthalen-1-yl)chrysen-6-yl]benzonitrile |
| SMILES | CC(C)c1cccc2cccc(-c3ccc4c(c3)c(-c3ccc(C#N)cc3)cc3c5ccccc5c(-c5ccc(C#N)cc5)cc43)c12 |
| InChI | InChI=1S/C45H30N2/c1-28(2)35-11-5-7-33-8-6-12-36(45(33)35)34-21-22-39-42(23-34)41(32-19-15-30(27-47)16-20-32)25-43-38-10-4-3-9-37(38)40(24-44(39)43)31-17-13-29(26-46)14-18-31/h3-25,28H,1-2H3 |
| InChIKey | MSHLSHKZTGNUOV-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|