C42H24N4 — CID 58771637
4-[4-[7-[4-(4-isocyanophenyl)naphthalen-1-yl]-1,8-naphthyridin-2-yl]naphthalen-1-yl]benzonitrile (PubChem CID 58771637) has the molecular formula C42H24N4 and a molecular weight of 584.68 g/mol. Its IUPAC name is 4-[4-[7-[4-(4-isocyanophenyl)naphthalen-1-yl]-1,8-naphthyridin-2-yl]naphthalen-1-yl]benzonitrile.
| Compound Name | 4-[4-[7-[4-(4-isocyanophenyl)naphthalen-1-yl]-1,8-naphthyridin-2-yl]naphthalen-1-yl]benzonitrile |
|---|---|
| PubChem CID | 58771637 |
| Molecular Formula | C42H24N4 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 4-[4-[7-[4-(4-isocyanophenyl)naphthalen-1-yl]-1,8-naphthyridin-2-yl]naphthalen-1-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3ccc4ccc(-c5ccc(-c6ccc(C#N)cc6)c6ccccc56)nc4n3)c3ccccc23)cc1 |
| InChI | InChI=1S/C42H24N4/c1-44-31-18-14-29(15-19-31)33-21-23-39(37-9-5-3-7-35(33)37)41-25-17-30-16-24-40(45-42(30)46-41)38-22-20-32(34-6-2-4-8-36(34)38)28-12-10-27(26-43)11-13-28/h2-25H |
| InChIKey | RHDFXYNXZQLRPF-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|