C36H21N3 — CID 164784541
4-[7-(4-isocyanophenyl)-9-naphthalen-1-ylcarbazol-2-yl]benzonitrile (PubChem CID 164784541) has the molecular formula C36H21N3 and a molecular weight of 495.59 g/mol. Its IUPAC name is 4-[7-(4-isocyanophenyl)-9-naphthalen-1-ylcarbazol-2-yl]benzonitrile.
| Compound Name | 4-[7-(4-isocyanophenyl)-9-naphthalen-1-ylcarbazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 164784541 |
| Molecular Formula | C36H21N3 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 4-[7-(4-isocyanophenyl)-9-naphthalen-1-ylcarbazol-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c4ccc(-c5ccc(C#N)cc5)cc4n(-c4cccc5ccccc45)c3c2)cc1 |
| InChI | InChI=1S/C36H21N3/c1-38-30-17-13-26(14-18-30)29-16-20-33-32-19-15-28(25-11-9-24(23-37)10-12-25)21-35(32)39(36(33)22-29)34-8-4-6-27-5-2-3-7-31(27)34/h2-22H |
| InChIKey | WINPWJUHMWQWPL-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|