C50H27N5 — CID 167090699
4-[2,6,7-tris(4-cyanophenyl)-9-naphthalen-1-ylcarbazol-3-yl]benzonitrile (PubChem CID 167090699) has the molecular formula C50H27N5 and a molecular weight of 697.80 g/mol. Its IUPAC name is 4-[2,6,7-tris(4-cyanophenyl)-9-naphthalen-1-ylcarbazol-3-yl]benzonitrile.
| Compound Name | 4-[2,6,7-tris(4-cyanophenyl)-9-naphthalen-1-ylcarbazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 167090699 |
| Molecular Formula | C50H27N5 |
| Molecular Weight | 697.80 g/mol |
| Exact Mass | 697.23 |
| IUPAC Name | 4-[2,6,7-tris(4-cyanophenyl)-9-naphthalen-1-ylcarbazol-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc3c4cc(-c5ccc(C#N)cc5)c(-c5ccc(C#N)cc5)cc4n(-c4cccc5ccccc45)c3cc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C50H27N5/c51-28-32-8-16-37(17-9-32)42-24-46-47-25-43(38-18-10-33(29-52)11-19-38)45(40-22-14-35(31-54)15-23-40)27-50(47)55(48-7-3-5-36-4-1-2-6-41(36)48)49(46)26-44(42)39-20-12-34(30-53)13-21-39/h1-27H |
| InChIKey | IAKQGGLSOLCXLI-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.80 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |