C67H36N8 — CID 157071593
2,5-bis[2-(4-cyanophenyl)-7-(4-isocyanophenyl)carbazol-9-yl]-4-(3-isocyano-5-methylphenyl)benzonitrile (PubChem CID 157071593) has the molecular formula C67H36N8 and a molecular weight of 953.08 g/mol. Its IUPAC name is 2,5-bis[2-(4-cyanophenyl)-7-(4-isocyanophenyl)carbazol-9-yl]-4-(3-isocyano-5-methylphenyl)benzonitrile.
| Compound Name | 2,5-bis[2-(4-cyanophenyl)-7-(4-isocyanophenyl)carbazol-9-yl]-4-(3-isocyano-5-methylphenyl)benzonitrile |
|---|---|
| PubChem CID | 157071593 |
| Molecular Formula | C67H36N8 |
| Molecular Weight | 953.08 g/mol |
| Exact Mass | 952.31 |
| IUPAC Name | 2,5-bis[2-(4-cyanophenyl)-7-(4-isocyanophenyl)carbazol-9-yl]-4-(3-isocyano-5-methylphenyl)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c4ccc(-c5ccc(C#N)cc5)cc4n(-c4cc(-c5cc(C)cc([N+]#[C-])c5)c(-n5c6cc(-c7ccc(C#N)cc7)ccc6c6ccc(-c7ccc([N+]#[C-])cc7)cc65)cc4C#N)c3c2)cc1 |
| InChI | InChI=1S/C67H36N8/c1-41-29-52(31-56(30-41)73-4)61-37-62(74-63-32-48(44-9-5-42(38-68)6-10-44)17-25-57(63)58-26-19-50(33-64(58)74)46-13-21-54(71-2)22-14-46)53(40-70)36-67(61)75-65-34-49(45-11-7-43(39-69)8-12-45)18-27-59(65)60-28-20-51(35-66(60)75)47-15-23-55(72-3)24-16-47/h5-37H,1H3 |
| InChIKey | NKCWLBWIQBDZSQ-UHFFFAOYSA-N |
| XLogP | 17.79 |
| TPSA | 94.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.08 |
| LogP ≤ 5 | 17.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|