C43H20F3N7 — CID 158394056
9-[2-cyano-4-(3,6-diisocyanocarbazol-9-yl)-5-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]carbazole-3,6-dicarbonitrile (PubChem CID 158394056) has the molecular formula C43H20F3N7 and a molecular weight of 691.68 g/mol. Its IUPAC name is 9-[2-cyano-4-(3,6-diisocyanocarbazol-9-yl)-5-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]carbazole-3,6-dicarbonitrile.
| Compound Name | 9-[2-cyano-4-(3,6-diisocyanocarbazol-9-yl)-5-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]carbazole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 158394056 |
| Molecular Formula | C43H20F3N7 |
| Molecular Weight | 691.68 g/mol |
| Exact Mass | 691.17 |
| IUPAC Name | 9-[2-cyano-4-(3,6-diisocyanocarbazol-9-yl)-5-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]carbazole-3,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc([N+]#[C-])ccc1n2-c1cc(C#N)c(-n2c3ccc(C#N)cc3c3cc(C#N)ccc32)cc1-c1cc(C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C43H20F3N7/c1-24-12-27(16-29(13-24)43(44,45)46)32-20-41(52-37-8-4-25(21-47)14-33(37)34-15-26(22-48)5-9-38(34)52)28(23-49)17-42(32)53-39-10-6-30(50-2)18-35(39)36-19-31(51-3)7-11-40(36)53/h4-20H,1H3 |
| InChIKey | MZPNDTFZEICYHB-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 89.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.68 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|