C41H19F3N6 — CID 155654198
9-[5-cyano-2-(3-cyanocarbazol-9-yl)-4-[3-isocyano-5-(trifluoromethyl)phenyl]phenyl]carbazole-3-carbonitrile (PubChem CID 155654198) has the molecular formula C41H19F3N6 and a molecular weight of 652.64 g/mol. Its IUPAC name is 9-[5-cyano-2-(3-cyanocarbazol-9-yl)-4-[3-isocyano-5-(trifluoromethyl)phenyl]phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[5-cyano-2-(3-cyanocarbazol-9-yl)-4-[3-isocyano-5-(trifluoromethyl)phenyl]phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 155654198 |
| Molecular Formula | C41H19F3N6 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | 9-[5-cyano-2-(3-cyanocarbazol-9-yl)-4-[3-isocyano-5-(trifluoromethyl)phenyl]phenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1cc(-c2cc(-n3c4ccccc4c4cc(C#N)ccc43)c(-n3c4ccccc4c4cc(C#N)ccc43)cc2C#N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C41H19F3N6/c1-48-29-17-26(16-28(19-29)41(42,43)44)32-20-40(50-36-9-5-3-7-31(36)34-15-25(22-46)11-13-38(34)50)39(18-27(32)23-47)49-35-8-4-2-6-30(35)33-14-24(21-45)10-12-37(33)49/h2-20H |
| InChIKey | WSLWURSTLJILKS-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|