C67H33F6N7 — CID 140846740
4-[3,5-bis(trifluoromethyl)phenyl]-2,5-bis[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]benzonitrile (PubChem CID 140846740) has the molecular formula C67H33F6N7 and a molecular weight of 1050.04 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-2,5-bis[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2,5-bis[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 140846740 |
| Molecular Formula | C67H33F6N7 |
| Molecular Weight | 1050.04 g/mol |
| Exact Mass | 1049.27 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2,5-bis[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)c2cc(-c4cccc(C#N)c4)ccc2n3-c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(-n3c4ccc(-c5cccc(C#N)c5)cc4c4cc(-c5cccc([N+]#[C-])c5)ccc43)cc2C#N)c1 |
| InChI | InChI=1S/C67H33F6N7/c1-77-53-13-5-11-43(27-53)47-17-20-61-57(31-47)56-29-45(41-9-3-7-39(23-41)36-74)15-19-60(56)79(61)64-35-55(49-25-51(66(68,69)70)34-52(26-49)67(71,72)73)65(33-50(64)38-76)80-62-21-16-46(42-10-4-8-40(24-42)37-75)30-58(62)59-32-48(18-22-63(59)80)44-12-6-14-54(28-44)78-2/h3-35H |
| InChIKey | SUQSHKGYYZIIDX-UHFFFAOYSA-N |
| XLogP | 18.97 |
| TPSA | 89.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1050.04 |
| LogP ≤ 5 | 18.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|