C41H19F6N5 — CID 153423014
9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-cyano-4-(3-isocyanocarbazol-9-yl)phenyl]carbazole-3-carbonitrile (PubChem CID 153423014) has the molecular formula C41H19F6N5 and a molecular weight of 695.63 g/mol. Its IUPAC name is 9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-cyano-4-(3-isocyanocarbazol-9-yl)phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-cyano-4-(3-isocyanocarbazol-9-yl)phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 153423014 |
| Molecular Formula | C41H19F6N5 |
| Molecular Weight | 695.63 g/mol |
| Exact Mass | 695.15 |
| IUPAC Name | 9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-cyano-4-(3-isocyanocarbazol-9-yl)phenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1cc(C#N)c(-n2c3ccccc3c3cc(C#N)ccc32)cc1-c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C41H19F6N5/c1-50-26-12-15-37-31(19-26)29-7-3-5-9-35(29)52(37)39-17-24(22-49)38(20-32(39)27-13-11-25(40(42,43)44)18-33(27)41(45,46)47)51-34-8-4-2-6-28(34)30-16-23(21-48)10-14-36(30)51/h2-20H |
| InChIKey | FEGZMLGAYPVOTK-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.63 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|