C43H17F6N7 — CID 153423050
9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-cyano-4-(2-cyano-7-isocyanocarbazol-9-yl)phenyl]-7-isocyanocarbazole-2-carbonitrile (PubChem CID 153423050) has the molecular formula C43H17F6N7 and a molecular weight of 745.65 g/mol. Its IUPAC name is 9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-cyano-4-(2-cyano-7-isocyanocarbazol-9-yl)phenyl]-7-isocyanocarbazole-2-carbonitrile.
| Compound Name | 9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-cyano-4-(2-cyano-7-isocyanocarbazol-9-yl)phenyl]-7-isocyanocarbazole-2-carbonitrile |
|---|---|
| PubChem CID | 153423050 |
| Molecular Formula | C43H17F6N7 |
| Molecular Weight | 745.65 g/mol |
| Exact Mass | 745.14 |
| IUPAC Name | 9-[5-[2,4-bis(trifluoromethyl)phenyl]-2-cyano-4-(2-cyano-7-isocyanocarbazol-9-yl)phenyl]-7-isocyanocarbazole-2-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c3ccc(C#N)cc3n(-c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)c(-n4c5cc(C#N)ccc5c5ccc([N+]#[C-])cc54)cc3C#N)c2c1 |
| InChI | InChI=1S/C43H17F6N7/c1-53-27-6-11-32-30-8-3-23(20-50)13-37(30)55(40(32)17-27)36-19-34(29-10-5-26(42(44,45)46)16-35(29)43(47,48)49)39(15-25(36)22-52)56-38-14-24(21-51)4-9-31(38)33-12-7-28(54-2)18-41(33)56/h3-19H |
| InChIKey | QUFXXCUOXPECFU-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 89.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.65 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|