C41H19F12N3 — CID 134473580
2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis[2-(trifluoromethyl)carbazol-9-yl]benzonitrile (PubChem CID 134473580) has the molecular formula C41H19F12N3 and a molecular weight of 781.60 g/mol. Its IUPAC name is 2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis[2-(trifluoromethyl)carbazol-9-yl]benzonitrile.
| Compound Name | 2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis[2-(trifluoromethyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 134473580 |
| Molecular Formula | C41H19F12N3 |
| Molecular Weight | 781.60 g/mol |
| Exact Mass | 781.14 |
| IUPAC Name | 2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis[2-(trifluoromethyl)carbazol-9-yl]benzonitrile |
| SMILES | N#Cc1cc(-n2c3ccccc3c3ccc(C(F)(F)F)cc32)c(-n2c3ccccc3c3ccc(C(F)(F)F)cc32)cc1-c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C41H19F12N3/c42-38(43,44)22-9-12-25(31(16-22)41(51,52)53)30-19-37(56-33-8-4-2-6-27(33)29-14-11-24(18-35(29)56)40(48,49)50)36(15-21(30)20-54)55-32-7-3-1-5-26(32)28-13-10-23(17-34(28)55)39(45,46)47/h1-19H |
| InChIKey | PBRUVFYGASEWDR-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.60 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |