C62H32F12N6 — CID 134321386
4,5-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 134321386) has the molecular formula C62H32F12N6 and a molecular weight of 1088.96 g/mol. Its IUPAC name is 4,5-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 4,5-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 134321386 |
| Molecular Formula | C62H32F12N6 |
| Molecular Weight | 1088.96 g/mol |
| Exact Mass | 1088.25 |
| IUPAC Name | 4,5-bis[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1cc(-n2c3ccccc3c3ccc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cc32)c(-n2c3ccccc3c3ccc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cc32)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C62H32F12N6/c63-59(64,65)39-21-25-41(48(30-39)61(69,70)71)36-19-23-45-43-15-7-9-17-50(43)79(52(45)27-36)54-29-38(33-75)47(58-77-56(34-11-3-1-4-12-34)76-57(78-58)35-13-5-2-6-14-35)32-55(54)80-51-18-10-8-16-44(51)46-24-20-37(28-53(46)80)42-26-22-40(60(66,67)68)31-49(42)62(72,73)74/h1-32H |
| InChIKey | YTVOPRFVXKEEAP-UHFFFAOYSA-N |
| XLogP | 18.35 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1088.96 |
| LogP ≤ 5 | 18.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |