C70H34F24N4 — CID 134292984
4,5-bis[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,6-dimethyl-4-pyridinyl)benzonitrile (PubChem CID 134292984) has the molecular formula C70H34F24N4 and a molecular weight of 1387.02 g/mol. Its IUPAC name is 4,5-bis[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,6-dimethyl-4-pyridinyl)benzonitrile.
| Compound Name | 4,5-bis[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,6-dimethyl-4-pyridinyl)benzonitrile |
|---|---|
| PubChem CID | 134292984 |
| Molecular Formula | C70H34F24N4 |
| Molecular Weight | 1387.02 g/mol |
| Exact Mass | 1386.24 |
| IUPAC Name | 4,5-bis[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,6-dimethyl-4-pyridinyl)benzonitrile |
| SMILES | Cc1cc(-c2cc(-n3c4cc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)ccc4c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc43)c(-n3c4cc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)ccc4c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc43)cc2C#N)cc(C)n1 |
| InChI | InChI=1S/C70H34F24N4/c1-32-19-38(20-33(2)96-32)52-30-62(98-59-23-36(46-17-9-42(65(77,78)79)28-55(46)69(89,90)91)5-13-50(59)51-14-6-37(24-60(51)98)47-18-10-43(66(80,81)82)29-56(47)70(92,93)94)61(25-39(52)31-95)97-57-21-34(44-15-7-40(63(71,72)73)26-53(44)67(83,84)85)3-11-48(57)49-12-4-35(22-58(49)97)45-16-8-41(64(74,75)76)27-54(45)68(86,87)88/h3-30H,1-2H3 |
| InChIKey | YCBLUPCLHFBUCI-UHFFFAOYSA-N |
| XLogP | 24.25 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1387.02 |
| LogP ≤ 5 | 24.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |