C71H53F6N3 — CID 139402110
4,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-2-[2,4-bis(trifluoromethyl)phenyl]benzonitrile (PubChem CID 139402110) has the molecular formula C71H53F6N3 and a molecular weight of 1062.21 g/mol. Its IUPAC name is 4,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-2-[2,4-bis(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 4,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-2-[2,4-bis(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 139402110 |
| Molecular Formula | C71H53F6N3 |
| Molecular Weight | 1062.21 g/mol |
| Exact Mass | 1061.41 |
| IUPAC Name | 4,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-2-[2,4-bis(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)c2cc(-c4cc(C)cc(C)c4)ccc2n3-c2cc(C#N)c(-c3ccc(C(F)(F)F)cc3C(F)(F)F)cc2-n2c3ccc(-c4cc(C)cc(C)c4)cc3c3cc(-c4cc(C)cc(C)c4)ccc32)c1 |
| InChI | InChI=1S/C71H53F6N3/c1-39-19-40(2)24-51(23-39)47-9-15-64-59(31-47)60-32-48(52-25-41(3)20-42(4)26-52)10-16-65(60)79(64)68-35-55(38-78)58(57-14-13-56(70(72,73)74)36-63(57)71(75,76)77)37-69(68)80-66-17-11-49(53-27-43(5)21-44(6)28-53)33-61(66)62-34-50(12-18-67(62)80)54-29-45(7)22-46(8)30-54/h9-37H,1-8H3 |
| InChIKey | CNKGLSKVWCGUCK-UHFFFAOYSA-N |
| XLogP | 20.59 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1062.21 |
| LogP ≤ 5 | 20.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |