C71H29F27N4 — CID 162571618
4,5-bis[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 162571618) has the molecular formula C71H29F27N4 and a molecular weight of 1450.99 g/mol. Its IUPAC name is 4,5-bis[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 4,5-bis[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 162571618 |
| Molecular Formula | C71H29F27N4 |
| Molecular Weight | 1450.99 g/mol |
| Exact Mass | 1450.20 |
| IUPAC Name | 4,5-bis[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1cc(-n2c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)ccc3c3ccc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cc32)c(-n2c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)ccc3c3ccc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cc32)cc1-c1c(C#N)cccc1C(F)(F)F |
| InChI | InChI=1S/C71H29F27N4/c72-63(73,74)38-8-16-42(52(25-38)68(87,88)89)32-4-12-46-47-13-5-33(43-17-9-39(64(75,76)77)26-53(43)69(90,91)92)21-57(47)101(56(46)20-32)60-24-37(31-100)50(62-36(30-99)2-1-3-51(62)67(84,85)86)29-61(60)102-58-22-34(44-18-10-40(65(78,79)80)27-54(44)70(93,94)95)6-14-48(58)49-15-7-35(23-59(49)102)45-19-11-41(66(81,82)83)28-55(45)71(96,97)98/h1-29H |
| InChIKey | SCQARRNHSZOJLA-UHFFFAOYSA-N |
| XLogP | 25.13 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 102 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1450.99 |
| LogP ≤ 5 | 25.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |