C66H38N8 — CID 134302144
4,5-bis[2,7-bis(2-cyanophenyl)carbazol-9-yl]-2-(2,6-dimethyl-4-pyridinyl)benzonitrile (PubChem CID 134302144) has the molecular formula C66H38N8 and a molecular weight of 943.09 g/mol. Its IUPAC name is 4,5-bis[2,7-bis(2-cyanophenyl)carbazol-9-yl]-2-(2,6-dimethyl-4-pyridinyl)benzonitrile.
| Compound Name | 4,5-bis[2,7-bis(2-cyanophenyl)carbazol-9-yl]-2-(2,6-dimethyl-4-pyridinyl)benzonitrile |
|---|---|
| PubChem CID | 134302144 |
| Molecular Formula | C66H38N8 |
| Molecular Weight | 943.09 g/mol |
| Exact Mass | 942.32 |
| IUPAC Name | 4,5-bis[2,7-bis(2-cyanophenyl)carbazol-9-yl]-2-(2,6-dimethyl-4-pyridinyl)benzonitrile |
| SMILES | Cc1cc(-c2cc(-n3c4cc(-c5ccccc5C#N)ccc4c4ccc(-c5ccccc5C#N)cc43)c(-n3c4cc(-c5ccccc5C#N)ccc4c4ccc(-c5ccccc5C#N)cc43)cc2C#N)cc(C)n1 |
| InChI | InChI=1S/C66H38N8/c1-40-27-50(28-41(2)72-40)60-34-66(74-63-31-44(54-17-9-5-13-48(54)37-69)21-25-58(63)59-26-22-45(32-64(59)74)55-18-10-6-14-49(55)38-70)65(33-51(60)39-71)73-61-29-42(52-15-7-3-11-46(52)35-67)19-23-56(61)57-24-20-43(30-62(57)73)53-16-8-4-12-47(53)36-68/h3-34H,1-2H3 |
| InChIKey | CXCDNVDKSHJONN-UHFFFAOYSA-N |
| XLogP | 15.59 |
| TPSA | 141.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.09 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |