C43H29F3N4 — CID 153303102
4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-bis(2,7-dimethylcarbazol-9-yl)benzonitrile (PubChem CID 153303102) has the molecular formula C43H29F3N4 and a molecular weight of 658.73 g/mol. Its IUPAC name is 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-bis(2,7-dimethylcarbazol-9-yl)benzonitrile.
| Compound Name | 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-bis(2,7-dimethylcarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 153303102 |
| Molecular Formula | C43H29F3N4 |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-bis(2,7-dimethylcarbazol-9-yl)benzonitrile |
| SMILES | Cc1ccc2c3ccc(C)cc3n(-c3cc(-c4ccc(C#N)cc4C(F)(F)F)c(-n4c5cc(C)ccc5c5ccc(C)cc54)cc3C#N)c2c1 |
| InChI | InChI=1S/C43H29F3N4/c1-24-5-10-31-32-11-6-25(2)16-39(32)49(38(31)15-24)37-21-35(30-14-9-28(22-47)19-36(30)43(44,45)46)42(20-29(37)23-48)50-40-17-26(3)7-12-33(40)34-13-8-27(4)18-41(34)50/h5-21H,1-4H3 |
| InChIKey | OUJFOYVBJZNLMZ-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |