C45H32N4 — CID 140722420
4-(N-[5-(N-(4-isocyanophenyl)anilino)-7,7-dimethylbenzo[g]fluoren-9-yl]anilino)benzonitrile (PubChem CID 140722420) has the molecular formula C45H32N4 and a molecular weight of 628.78 g/mol. Its IUPAC name is 4-(N-[5-(N-(4-isocyanophenyl)anilino)-7,7-dimethylbenzo[g]fluoren-9-yl]anilino)benzonitrile.
| Compound Name | 4-(N-[5-(N-(4-isocyanophenyl)anilino)-7,7-dimethylbenzo[g]fluoren-9-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 140722420 |
| Molecular Formula | C45H32N4 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 4-(N-[5-(N-(4-isocyanophenyl)anilino)-7,7-dimethylbenzo[g]fluoren-9-yl]anilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccccc2)c2cc3c(c4ccccc24)-c2ccc(N(c4ccccc4)c4ccc(C#N)cc4)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C45H32N4/c1-45(2)41-28-37(48(33-12-6-4-7-13-33)35-22-18-31(30-46)19-23-35)26-27-40(41)44-39-17-11-10-16-38(39)43(29-42(44)45)49(34-14-8-5-9-15-34)36-24-20-32(47-3)21-25-36/h4-29H,1-2H3 |
| InChIKey | GGYGZLZHAJKRES-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|