C51H36N4 — CID 140926370
4-(N-[2-(N-(4-isocyanophenyl)anilino)-11,11-dimethylbenzo[b]fluoren-8-yl]-4-phenylanilino)benzonitrile (PubChem CID 140926370) has the molecular formula C51H36N4 and a molecular weight of 704.88 g/mol. Its IUPAC name is 4-(N-[2-(N-(4-isocyanophenyl)anilino)-11,11-dimethylbenzo[b]fluoren-8-yl]-4-phenylanilino)benzonitrile.
| Compound Name | 4-(N-[2-(N-(4-isocyanophenyl)anilino)-11,11-dimethylbenzo[b]fluoren-8-yl]-4-phenylanilino)benzonitrile |
|---|---|
| PubChem CID | 140926370 |
| Molecular Formula | C51H36N4 |
| Molecular Weight | 704.88 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | 4-(N-[2-(N-(4-isocyanophenyl)anilino)-11,11-dimethylbenzo[b]fluoren-8-yl]-4-phenylanilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccccc2)c2ccc3c(c2)C(C)(C)c2cc4cc(N(c5ccc(C#N)cc5)c5ccc(-c6ccccc6)cc5)ccc4cc2-3)cc1 |
| InChI | InChI=1S/C51H36N4/c1-51(2)49-32-39-30-45(55(42-21-14-35(34-52)15-22-42)43-23-16-37(17-24-43)36-10-6-4-7-11-36)25-18-38(39)31-48(49)47-29-28-46(33-50(47)51)54(41-12-8-5-9-13-41)44-26-19-40(53-3)20-27-44/h4-33H,1-2H3 |
| InChIKey | RKSMIFATGUNMLF-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.88 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|