C54H37N3 — CID 123615196
4-[2-(N-(9,9-dimethylfluoren-2-yl)-2-phenylanilino)-9-(4-isocyanophenyl)fluoren-9-yl]benzonitrile (PubChem CID 123615196) has the molecular formula C54H37N3 and a molecular weight of 727.91 g/mol. Its IUPAC name is 4-[2-(N-(9,9-dimethylfluoren-2-yl)-2-phenylanilino)-9-(4-isocyanophenyl)fluoren-9-yl]benzonitrile.
| Compound Name | 4-[2-(N-(9,9-dimethylfluoren-2-yl)-2-phenylanilino)-9-(4-isocyanophenyl)fluoren-9-yl]benzonitrile |
|---|---|
| PubChem CID | 123615196 |
| Molecular Formula | C54H37N3 |
| Molecular Weight | 727.91 g/mol |
| Exact Mass | 727.30 |
| IUPAC Name | 4-[2-(N-(9,9-dimethylfluoren-2-yl)-2-phenylanilino)-9-(4-isocyanophenyl)fluoren-9-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(C2(c3ccc(C#N)cc3)c3ccccc3-c3ccc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccccc4-c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C54H37N3/c1-53(2)48-18-10-7-16-44(48)46-31-29-41(33-50(46)53)57(52-20-12-9-15-43(52)37-13-5-4-6-14-37)42-30-32-47-45-17-8-11-19-49(45)54(51(47)34-42,38-23-21-36(35-55)22-24-38)39-25-27-40(56-3)28-26-39/h4-34H,1-2H3 |
| InChIKey | YNINWLXQGUIPFV-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.91 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|