C64H41N3 — CID 140725988
N-[9,9-bis(4-isocyanophenyl)fluoren-3-yl]-9,9-diphenyl-N-(2-phenylphenyl)fluoren-2-amine (PubChem CID 140725988) has the molecular formula C64H41N3 and a molecular weight of 852.05 g/mol. Its IUPAC name is N-[9,9-bis(4-isocyanophenyl)fluoren-3-yl]-9,9-diphenyl-N-(2-phenylphenyl)fluoren-2-amine.
| Compound Name | N-[9,9-bis(4-isocyanophenyl)fluoren-3-yl]-9,9-diphenyl-N-(2-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 140725988 |
| Molecular Formula | C64H41N3 |
| Molecular Weight | 852.05 g/mol |
| Exact Mass | 851.33 |
| IUPAC Name | N-[9,9-bis(4-isocyanophenyl)fluoren-3-yl]-9,9-diphenyl-N-(2-phenylphenyl)fluoren-2-amine |
| SMILES | [C-]#[N+]c1ccc(C2(c3ccc([N+]#[C-])cc3)c3ccccc3-c3cc(N(c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4-5)c4ccccc4-c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C64H41N3/c1-65-49-34-30-47(31-35-49)63(48-32-36-50(66-2)37-33-48)59-28-16-13-26-55(59)57-42-51(39-41-60(57)63)67(62-29-17-14-24-53(62)44-18-6-3-7-19-44)52-38-40-56-54-25-12-15-27-58(54)64(61(56)43-52,45-20-8-4-9-21-45)46-22-10-5-11-23-46/h3-43H |
| InChIKey | AIHZUDFAYGBXJF-UHFFFAOYSA-N |
| XLogP | 16.65 |
| TPSA | 11.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.05 |
| LogP ≤ 5 | 16.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|