C82H53N5 — CID 123836837
4-[(9,9-diphenylfluoren-2-yl)-[6-(N-(9,9-diphenylfluoren-2-yl)-4-isocyanoanilino)-9-phenylcarbazol-3-yl]amino]benzonitrile (PubChem CID 123836837) has the molecular formula C82H53N5 and a molecular weight of 1108.36 g/mol. Its IUPAC name is 4-[(9,9-diphenylfluoren-2-yl)-[6-(N-(9,9-diphenylfluoren-2-yl)-4-isocyanoanilino)-9-phenylcarbazol-3-yl]amino]benzonitrile.
| Compound Name | 4-[(9,9-diphenylfluoren-2-yl)-[6-(N-(9,9-diphenylfluoren-2-yl)-4-isocyanoanilino)-9-phenylcarbazol-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 123836837 |
| Molecular Formula | C82H53N5 |
| Molecular Weight | 1108.36 g/mol |
| Exact Mass | 1107.43 |
| IUPAC Name | 4-[(9,9-diphenylfluoren-2-yl)-[6-(N-(9,9-diphenylfluoren-2-yl)-4-isocyanoanilino)-9-phenylcarbazol-3-yl]amino]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c2ccc3c(c2)c2cc(N(c4ccc(C#N)cc4)c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4-5)ccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C82H53N5/c1-84-61-37-41-64(42-38-61)86(68-44-48-72-70-32-18-20-34-76(70)82(78(72)54-68,59-25-11-4-12-26-59)60-27-13-5-14-28-60)66-46-50-80-74(52-66)73-51-65(45-49-79(73)87(80)62-29-15-6-16-30-62)85(63-39-35-56(55-83)36-40-63)67-43-47-71-69-31-17-19-33-75(69)81(77(71)53-67,57-21-7-2-8-22-57)58-23-9-3-10-24-58/h2-54H |
| InChIKey | JLEKVNAPDLBAEH-UHFFFAOYSA-N |
| XLogP | 20.87 |
| TPSA | 39.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.36 |
| LogP ≤ 5 | 20.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|