C54H40N6 — CID 58232288
4-(4-cyano-N-[2-(4-isocyano-N-(4-isocyanophenyl)anilino)-4,7,11,11,12,12-hexamethylindeno[2,1-a]fluoren-9-yl]anilino)benzonitrile (PubChem CID 58232288) has the molecular formula C54H40N6 and a molecular weight of 772.96 g/mol. Its IUPAC name is 4-(4-cyano-N-[2-(4-isocyano-N-(4-isocyanophenyl)anilino)-4,7,11,11,12,12-hexamethylindeno[2,1-a]fluoren-9-yl]anilino)benzonitrile.
| Compound Name | 4-(4-cyano-N-[2-(4-isocyano-N-(4-isocyanophenyl)anilino)-4,7,11,11,12,12-hexamethylindeno[2,1-a]fluoren-9-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 58232288 |
| Molecular Formula | C54H40N6 |
| Molecular Weight | 772.96 g/mol |
| Exact Mass | 772.33 |
| IUPAC Name | 4-(4-cyano-N-[2-(4-isocyano-N-(4-isocyanophenyl)anilino)-4,7,11,11,12,12-hexamethylindeno[2,1-a]fluoren-9-yl]anilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc([N+]#[C-])cc2)c2cc(C)c3c(c2)C(C)(C)c2c-3ccc3c2C(C)(C)c2cc(N(c4ccc(C#N)cc4)c4ccc(C#N)cc4)cc(C)c2-3)cc1 |
| InChI | InChI=1S/C54H40N6/c1-33-27-43(59(39-17-9-35(31-55)10-18-39)40-19-11-36(32-56)12-20-40)29-47-49(33)45-25-26-46-50-34(2)28-44(30-48(50)54(5,6)52(46)51(45)53(47,3)4)60(41-21-13-37(57-7)14-22-41)42-23-15-38(58-8)16-24-42/h9-30H,1-6H3 |
| InChIKey | AKOSTSQSVHGWBL-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 62.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.96 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|