C54H48N4 — CID 143896101
4-(N-[2-(N-(4-cyanophenyl)-4-methylanilino)-4,6,6,10,12,12-hexamethyl-8,9-dihydroindeno[1,2-b]fluoren-8-yl]-4-methylanilino)benzonitrile (PubChem CID 143896101) has the molecular formula C54H48N4 and a molecular weight of 753.01 g/mol. Its IUPAC name is 4-(N-[2-(N-(4-cyanophenyl)-4-methylanilino)-4,6,6,10,12,12-hexamethyl-8,9-dihydroindeno[1,2-b]fluoren-8-yl]-4-methylanilino)benzonitrile.
| Compound Name | 4-(N-[2-(N-(4-cyanophenyl)-4-methylanilino)-4,6,6,10,12,12-hexamethyl-8,9-dihydroindeno[1,2-b]fluoren-8-yl]-4-methylanilino)benzonitrile |
|---|---|
| PubChem CID | 143896101 |
| Molecular Formula | C54H48N4 |
| Molecular Weight | 753.01 g/mol |
| Exact Mass | 752.39 |
| IUPAC Name | 4-(N-[2-(N-(4-cyanophenyl)-4-methylanilino)-4,6,6,10,12,12-hexamethyl-8,9-dihydroindeno[1,2-b]fluoren-8-yl]-4-methylanilino)benzonitrile |
| SMILES | CC1=C2C(=CC(N(c3ccc(C)cc3)c3ccc(C#N)cc3)C1)C(C)(C)c1cc3c(cc12)C(C)(C)c1cc(N(c2ccc(C)cc2)c2ccc(C#N)cc2)cc(C)c1-3 |
| InChI | InChI=1S/C54H48N4/c1-33-9-17-39(18-10-33)57(41-21-13-37(31-55)14-22-41)43-25-35(3)51-45-29-48-46(30-47(45)53(5,6)49(51)27-43)52-36(4)26-44(28-50(52)54(48,7)8)58(40-19-11-34(2)12-20-40)42-23-15-38(32-56)16-24-42/h9-25,27-30,44H,26H2,1-8H3 |
| InChIKey | ZFGAUFRQFQWDRN-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.01 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |