C53H47F3N2 — CID 58232260
4,6,6,12,12-pentamethyl-2-N,8-N-bis(2-methylphenyl)-2-N-(4-methylphenyl)-8-N-[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluorene-2,8-diamine (PubChem CID 58232260) has the molecular formula C53H47F3N2 and a molecular weight of 768.97 g/mol. Its IUPAC name is 4,6,6,12,12-pentamethyl-2-N,8-N-bis(2-methylphenyl)-2-N-(4-methylphenyl)-8-N-[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluorene-2,8-diamine.
| Compound Name | 4,6,6,12,12-pentamethyl-2-N,8-N-bis(2-methylphenyl)-2-N-(4-methylphenyl)-8-N-[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluorene-2,8-diamine |
|---|---|
| PubChem CID | 58232260 |
| Molecular Formula | C53H47F3N2 |
| Molecular Weight | 768.97 g/mol |
| Exact Mass | 768.37 |
| IUPAC Name | 4,6,6,12,12-pentamethyl-2-N,8-N-bis(2-methylphenyl)-2-N-(4-methylphenyl)-8-N-[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluorene-2,8-diamine |
| SMILES | Cc1ccc(N(c2cc(C)c3c(c2)C(C)(C)c2cc4c(cc2-3)C(C)(C)c2cc(N(c3ccc(C(F)(F)F)cc3)c3ccccc3C)ccc2-4)c2ccccc2C)cc1 |
| InChI | InChI=1S/C53H47F3N2/c1-32-17-21-37(22-18-32)58(49-16-12-10-14-34(49)3)40-27-35(4)50-43-31-45-42(30-46(43)52(7,8)47(50)29-40)41-26-25-39(28-44(41)51(45,5)6)57(48-15-11-9-13-33(48)2)38-23-19-36(20-24-38)53(54,55)56/h9-31H,1-8H3 |
| InChIKey | XYURPKXJERLHJD-UHFFFAOYSA-N |
| XLogP | 15.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.97 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |