C52H42F6N2 — CID 88954286
5,6,11,11,12,12-hexamethyl-2-N,9-N-diphenyl-2-N,9-N-bis[4-(trifluoromethyl)phenyl]indeno[2,1-a]fluorene-2,9-diamine (PubChem CID 88954286) has the molecular formula C52H42F6N2 and a molecular weight of 808.91 g/mol. Its IUPAC name is 5,6,11,11,12,12-hexamethyl-2-N,9-N-diphenyl-2-N,9-N-bis[4-(trifluoromethyl)phenyl]indeno[2,1-a]fluorene-2,9-diamine.
| Compound Name | 5,6,11,11,12,12-hexamethyl-2-N,9-N-diphenyl-2-N,9-N-bis[4-(trifluoromethyl)phenyl]indeno[2,1-a]fluorene-2,9-diamine |
|---|---|
| PubChem CID | 88954286 |
| Molecular Formula | C52H42F6N2 |
| Molecular Weight | 808.91 g/mol |
| Exact Mass | 808.33 |
| IUPAC Name | 5,6,11,11,12,12-hexamethyl-2-N,9-N-diphenyl-2-N,9-N-bis[4-(trifluoromethyl)phenyl]indeno[2,1-a]fluorene-2,9-diamine |
| SMILES | Cc1c(C)c2c(c3c1-c1ccc(N(c4ccccc4)c4ccc(C(F)(F)F)cc4)cc1C3(C)C)C(C)(C)c1cc(N(c3ccccc3)c3ccc(C(F)(F)F)cc3)ccc1-2 |
| InChI | InChI=1S/C52H42F6N2/c1-31-32(2)46-42-28-26-40(60(36-15-11-8-12-16-36)38-23-19-34(20-24-38)52(56,57)58)30-44(42)50(5,6)48(46)47-45(31)41-27-25-39(29-43(41)49(47,3)4)59(35-13-9-7-10-14-35)37-21-17-33(18-22-37)51(53,54)55/h7-30H,1-6H3 |
| InChIKey | KAEGKJGPQCMKNP-UHFFFAOYSA-N |
| XLogP | 15.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.91 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |