C52H48N2 — CID 58232518
5-tert-butyl-11,11,12,12-tetramethyl-2-N,2-N,9-N,9-N-tetraphenylindeno[2,1-a]fluorene-2,9-diamine (PubChem CID 58232518) has the molecular formula C52H48N2 and a molecular weight of 700.97 g/mol. Its IUPAC name is 5-tert-butyl-11,11,12,12-tetramethyl-2-N,2-N,9-N,9-N-tetraphenylindeno[2,1-a]fluorene-2,9-diamine.
| Compound Name | 5-tert-butyl-11,11,12,12-tetramethyl-2-N,2-N,9-N,9-N-tetraphenylindeno[2,1-a]fluorene-2,9-diamine |
|---|---|
| PubChem CID | 58232518 |
| Molecular Formula | C52H48N2 |
| Molecular Weight | 700.97 g/mol |
| Exact Mass | 700.38 |
| IUPAC Name | 5-tert-butyl-11,11,12,12-tetramethyl-2-N,2-N,9-N,9-N-tetraphenylindeno[2,1-a]fluorene-2,9-diamine |
| SMILES | CC(C)(C)c1cc2c(c3c1-c1ccc(N(c4ccccc4)c4ccccc4)cc1C3(C)C)C(C)(C)c1cc(N(c3ccccc3)c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C52H48N2/c1-50(2,3)46-34-43-41-30-28-39(53(35-20-12-8-13-21-35)36-22-14-9-15-23-36)32-44(41)51(4,5)48(43)49-47(46)42-31-29-40(33-45(42)52(49,6)7)54(37-24-16-10-17-25-37)38-26-18-11-19-27-38/h8-34H,1-7H3 |
| InChIKey | UOVZIXLHZMQTIB-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.97 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |